Spautin-1 25mg
Spautin-1 is a novel autophagy inhibitor, IM inhibited the growth of K562 cells with IC50 of 1.03??M. In contrast, co-treatment with Spautin-1 increased IM-induced inhibition of cell viability with IC50 of 0.45 uM.
| Trivial name | Spautin-1 25mg |
| Catalog Number | A12942-25 |
| Alternative Name(s) | 6-fluoro-N-[(4-fluorophenyl)methyl]quinazolin-4-amine |
| Molecular Formula | C15H11F2N3 |
| CAS# | 1262888-28-7 |
| SMILES | FC1=CC(C(NCC2=CC=C(F)C=C2)=NC=N3)=C3C=C1 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/spautin-1.html |
