P 22077 10mM * 1mL in DMSO
P 22077 is a cell-permeable inhibitor of the ubiquitin-specific protease (IC?? = 8.6 ?M) and the closely related deubiquitinase (DUB) USP47.
| Trivial name | P 22077 10mM * 1mL in DMSO |
| Catalog Number | A12933-10mM-D |
| Alternative Name(s) | 1-[5-[(2,4-Difluorophenyl)thio]-4-n?itro-2-thienyl]-ethanone |
| Molecular Formula | C12H7F2NO3S2 |
| CAS# | 1247819-59-5 |
| SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/p-22077.html |
