MI 2 10mM * 1mL in DMSO
MI 2 binds directly to MALT1 and suppresses activated B cell-like diffuse large B cell lymphoma (ABC-DLBCL) in vitro and in vivo.
Trivial name | MI 2 10mM * 1mL in DMSO |
Catalog Number | A12928-10mM-D |
Alternative Name(s) | 2-chloro-N-(4-(5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl)phenyl)acetamide |
Molecular Formula | C19H17Cl3N4O3 |
CAS# | 1047953-91-2 |
SMILES | COCCOC1=NN(C(=N1)C2=CC(=C(C=C2)Cl)Cl)C3=CC=C(C=C3)NC(=O)CCl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/mi-2.html |