Sabutoclax 10mM * 1mL in DMSO
Sabutoclax(BI-97C1) is a pan-Bcl-2 inhibitor, including Bcl-xL, Bcl-2, Mcl-1 and Bfl-1 with IC50 of 0.31 ??M, 0.32 ??M, 0.20 ??M and 0.62 ??M, respectively.
| Trivial name | Sabutoclax 10mM * 1mL in DMSO |
| Catalog Number | A12823-10mM-D |
| Alternative Name(s) | [2,2'-Binaphthalene]-5,5'-dicarboxamide, 1,1',6,6',7,7'-hexahydroxy-3,3'-dimethyl-N5,N5'-bis[(2R)-2-phenylpropyl]-, (1R) |
| Molecular Formula | C42H40N2O8 |
| CAS# | 1228108-65-3 |
| SMILES | CC1=C(C(=C2C=C(C(=C(C2=C1)C(=O)NC[C@H](C)C3=CC=CC=C3)O)O)O)C4=C(C=C5C(=C4O)C=C(C(=C5C(=O)NC[C@H](C)C6=CC=CC=C6)O)O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/sabutoclax.html |