Ibutamoren (MK-677) 50mg
Ibutamoren, also known as MK-677 (L-163,191), is a drug which acts as a potent, orally active growth hormone secretagogue, mimicking the GH stimulating action of the endogenous hormone ghrelin.
| Trivial name | Ibutamoren (MK-677) 50mg |
| Catalog Number | A12802-50 |
| Alternative Name(s) | 2-amino-2-methyl-N-[(2R)-1-(1-methylsulfonylspiro[2H-indole-3,4'-piperidine]-1'-yl)-1-oxo-3-(phenylmethoxy)propan-2-yl]propanamide |
| Molecular Formula | C27H36N4O5S |
| CAS# | 159634-47-6 |
| SMILES | CC(C)(C(=O)N[C@H](COCC1=CC=CC=C1)C(=O)N2CCC3(CC2)CN(C4=CC=CC=C34)S(=O)(=O)C)N |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/ibutamoren-mk-677.html |
