PF-5274857 10mM * 1mL in DMSO
PF-5274857 is a novel Smo antagonist that specifically binds to Smo with a K(i) of 4.6 ?? 1.1 nmol/L and completely blocks the transcriptional activity of the downstream gene Gli1 with an IC(50) of 2.7 ?? 1.4 nmol/L in cells.
| Trivial name | PF-5274857 10mM * 1mL in DMSO |
| Catalog Number | A12775-10mM-D |
| Alternative Name(s) | 1-(4-(5-chloro-4-(3,5-diMethylpyridin-2-yl)pyridin-2-yl)piperazin-1-yl)-3-(Methylsulfonyl)propan-1-one |
| Molecular Formula | C20H25ClN4O3S |
| CAS# | 1373615-35-0 |
| SMILES | CC1=CC(=C(N=C1)C2=CC(=NC=C2Cl)N3CCN(CC3)C(=O)CCS(=O)(=O)C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pf-5274857.html |