Stattic 10mM * 1mL in DMSO
Stattic is a small molecule shown to selectively inhibit the activation of the Stat3 transcription factor by blocking phosphorylation and dimerization events.
| Trivial name | Stattic 10mM * 1mL in DMSO |
| Catalog Number | A12733-10mM-D |
| Alternative Name(s) | 6-Nitrobenzo[b]thiophene-1,1-dioxide |
| Molecular Formula | C8H5NO4S |
| CAS# | 19983-44-9 |
| SMILES | C1=CC(=CC2=C1C=CS2(=O)=O)[N+](=O)[O-] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/stattic.html |
