PRT062607 HCL 10mM * 1mL in DMSO
PRT2607, also known as PRT062607, P505-15, and BIIB057, is a novel, highly selective, and orally bioavailable small molecule SYK inhibitor (SYK IC(50) = 1 nM) with anti-SYK activity that is at least 80-fold greater than its affinity for other kinases.
| Trivial name | PRT062607 HCL 10mM * 1mL in DMSO |
| Catalog Number | A12731-10mM-D |
| Alternative Name(s) | 4-((3-(2H-1,2,3-triazol-2-yl)phenyl)amino)-2-(((1R,2S)-2-aminocyclohexyl)amino)pyrimidine-5-carboxamide hydrochloride |
| Molecular Formula | C19H24ClN9O |
| CAS# | 1370261-97-4 |
| SMILES | C1CC[C@H]([C@H](C1)N)NC2=NC=C(C(=N2)NC3=CC=CC(=C3)N4N=CC=N4)C(=O)N.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/prt062607-hcl.html |
