Teglarinad chloride 5mg
Teglarinad chloride, also known as GMX1777, is a water-soluble prodrug of a cyanoguanidine compound with potential antineoplastic activity. In vivo, teglarinad chloride is rapidly converted into active drug through hydrolytic cleavage of a carbonate ester bond.
Trivial name | Teglarinad chloride 5mg |
Catalog Number | A12669-5 |
Alternative Name(s) | 1-[[[[2-[2-[2-[2-Methoxyethoxy]ethoxy]ethoxy]ethoxy]carbonyl]oxy]methyl]-4-[N'-cyano-N''-[6-[4-chlorophenoxy]hexyl]guanidino]pyridinium chloride |
Molecular Formula | C30H43ClN5O8.Cl |
CAS# | 432037-57-5 |
SMILES | COCCOCCOCCOCCOC(=O)OC[N+]1=CC=C(C=C1)NC(=NCCCCCCOC2=CC=C(C=C2)Cl)NC#N.[Cl-] |
Size | 5mg |
Supplier Page | http://www.adooq.com/teglarinad-chloride.html |