Teglarinad chloride 10mg
Teglarinad chloride, also known as GMX1777, is a water-soluble prodrug of a cyanoguanidine compound with potential antineoplastic activity. In vivo, teglarinad chloride is rapidly converted into active drug through hydrolytic cleavage of a carbonate ester bond.
| Trivial name | Teglarinad chloride 10mg |
| Catalog Number | A12669-10 |
| Alternative Name(s) | 1-[[[[2-[2-[2-[2-Methoxyethoxy]ethoxy]ethoxy]ethoxy]carbonyl]oxy]methyl]-4-[N'-cyano-N''-[6-[4-chlorophenoxy]hexyl]guanidino]pyridinium chloride |
| Molecular Formula | C30H43ClN5O8.Cl |
| CAS# | 432037-57-5 |
| SMILES | COCCOCCOCCOCCOC(=O)OC[N+]1=CC=C(C=C1)NC(=NCCCCCCOC2=CC=C(C=C2)Cl)NC#N.[Cl-] |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/teglarinad-chloride.html |
