Melanotan II 5mg
Melanotan II is a high affinity melanocortin receptor agonist (Ki values are 0.67, 6.6, 34 and 46 nM for MC1, MC4, MC3 and MC5 receptors respectively).
| Trivial name | Melanotan II 5mg |
| Catalog Number | A12646-5 |
| Alternative Name(s) | N-Acetyl-L-norleucyl-L-alpha-aspartyl-L-histidyl-D-phenylalanyl-L-arginyl-L-tryptophyl-L-lysinamide (2->7)-lactam; Ac-Nle-Asp-His-D-Phe-Arg-Trp-Lys-NH2; Ac-[Nle4,Asp5,D-Phe7,Lys10]alpha-MSH-(4-10)-NH2 |
| Molecular Formula | C50H69N15O9 |
| CAS# | 121062-08-6 |
| SMILES | CCCC[C@@H](C(=O)N[C@H]1CC(=O)NCCCC[C@H](NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@@H](NC1=O)CC2=CN=CN2)CC3=CC=CC=C3)CCCN=C(N)N)CC4=CNC5=CC=CC=C54)C(=O)N)NC(=O)C |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/melanotan-ii.html |
