MSX-122 100mg
MSX-122 is an orally bioavailable inhibitor of CXCR4 with potential antineoplastic and antiviral activities. CXCR4 inhibitor MSX-122 binds to the chemokine receptor CXCR4, preventing the binding of stromal derived factor-1 (SDF-1) to the CXCR4 receptor and receptor activation, which may result in decreased tumor cell proliferation and migration.
| Trivial name | MSX-122 100mg |
| Catalog Number | A12596-100 |
| Alternative Name(s) | N,N'-(1,4-phenylenebis(methylene))bis(pyrimidin-2-amine) |
| Molecular Formula | C16H16N6 |
| CAS# | 897657-95-3 |
| SMILES | C1=CN=C(N=C1)NCC2=CC=C(C=C2)CNC3=NC=CC=N3 |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/msx-122.html |
