MPEP hydrochloride 25mg
MPEP hydrochloride is a potent and highly selective non-competitive antagonist at the mGlu5 receptor subtype (IC50 = 36 nM) and a positive allosteric modulator at mGlu4 receptors.
| Trivial name | MPEP hydrochloride 25mg |
| Catalog Number | A12589-25 |
| Alternative Name(s) | 2-Methyl-6-(phenylethynyl)pyridine hydrochloride |
| Molecular Formula | C14H11N.HCl |
| CAS# | 96206-92-7 |
| SMILES | CC1=CC=CC(=N1)C#CC2=CC=CC=C2.Cl |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/mpep-hydrochloride.html |