MPEP hydrochloride 10mM * 1mL in DMSO
MPEP hydrochloride is a potent and highly selective non-competitive antagonist at the mGlu5 receptor subtype (IC50 = 36 nM) and a positive allosteric modulator at mGlu4 receptors.
Trivial name | MPEP hydrochloride 10mM * 1mL in DMSO |
Catalog Number | A12589-10mM-D |
Alternative Name(s) | 2-Methyl-6-(phenylethynyl)pyridine hydrochloride |
Molecular Formula | C14H11N.HCl |
CAS# | 96206-92-7 |
SMILES | CC1=CC=CC(=N1)C#CC2=CC=CC=C2.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/mpep-hydrochloride.html |