PF-00562271 10mM * 1mL in DMSO
PF-00562271 is the benzenesulfonate salt of PF-562271, which is a potent, ATP-competitive, reversible inhibitor of FAK and Pyk2 with IC50 of 1.5 nM and 14 nM, respectively.
| Trivial name | PF-00562271 10mM * 1mL in DMSO |
| Catalog Number | A12580-10mM-D |
| Alternative Name(s) | N-methyl-N-(3-((2-(2-oxoindolin-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-ylamino)methyl)pyridin-2-yl)methanesulfonamide benzenesulfonate |
| Molecular Formula | C21H20F3N7O3S.C6H6O3S |
| CAS# | 939791-38-5 |
| SMILES | CN(C1=C(C=CC=N1)CNC2=NC(=NC=C2C(F)(F)F)NC3=CC4=C(C=C3)NC(=O)C4)S(=O)(=O)C.C1=CC=C(C=C1)S(=O)(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pf-00562271.html |
