Betrixaban 50mg
Betrixaban is an anticoagulant drug which acts as a direct factor Xa inhibitor. It is potent, orally active and highly selective for factor Xa, being selected from a group of similar compounds for its low hERG affinity.
| Trivial name | Betrixaban 50mg |
| Catalog Number | A12518-50 |
| Alternative Name(s) | N-(5-chloropyridin-2-yl)-2-([4-(N,N-dimethylcarbamimidoyl)benzoyl]amino)-5-methoxybenzamide |
| Molecular Formula | C23H22ClN5O3 |
| CAS# | 330942-05-7 |
| SMILES | CN(C)C(=N)C1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)OC)C(=O)NC3=NC=C(C=C3)Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/betrixaban.html |
