TCS ERK 11e (VX-11e) 10mg
TCS ERK 11e (VX-11e) is a potent and selective extracellular signal-related kinase 2 (ERK2) inhibitor (Ki values are <2, 395, 540 and 852 nM for ERK2, GSK-3, Aurora Kinase A and Cdk2 respectively). Potently blocks proliferation of HT29 cells (IC50 = 48 nM).
| Trivial name | TCS ERK 11e (VX-11e) 10mg |
| Catalog Number | A12505-10 |
| Alternative Name(s) | 4-[2-[(2-Chloro-4-fluorophenyl)amin?o]-5-methyl-4-pyrimidinyl]-N-[(1S)-1-(3-chlorophen?yl)-2-hydroxyethyl]-1H-pyrrole-2-carboxamide |
| Molecular Formula | C24H20Cl2FN5O2 |
| CAS# | 896720-20-0 |
| SMILES | CC1=CN=C(N=C1C2=CNC(=C2)C(=O)N[C@H](CO)C3=CC(=CC=C3)Cl)NC4=C(C=C(C=C4)F)Cl |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/tcs-erk-11e-vx-11e.html |