VU 0361737 10mM * 1mL in DMSO
VU 0361737 is a selective positive allosteric modulator at mGluR-4 (EC50 values are 240 and 110 nM at human and rat receptors respectively).
| Trivial name | VU 0361737 10mM * 1mL in DMSO |
| Catalog Number | A12467-10mM-D |
| Alternative Name(s) | N-(4-Chloro-3-methoxyphenyl)-2-pyridinecarboxamide |
| Molecular Formula | C13H11ClN2O2 |
| CAS# | 1161205-04-4 |
| SMILES | COC1=C(C=CC(=C1)NC(=O)C2=CC=CC=N2)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/vu-0361737.html |
