Pifithrin-alpha 10mM * 1mL in DMSO
Pifithrin-a is a reversible inhibitor of p53-mediated apoptosis and p53-dependent gene transcription such as cyclin G, p21/waf1, and mdm2 expression.
Trivial name | Pifithrin-alpha 10mM * 1mL in DMSO |
Catalog Number | A12451-10mM-D |
Alternative Name(s) | 2-(2-Imino-4,5,6,7-tetrahydrobenzothiazol-3-yl)-1-p-tolylethanone hydrobromide |
Molecular Formula | C16H18N2OS.HBr |
CAS# | 63208-82-2 |
SMILES | CC1=CC=C(C=C1)C(=O)CN2C3=C(CCCC3)SC2=N.Br |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/pifithrin-alpha.html |