TCS 359 10mM * 1mL in DMSO
TCS 359 is a potent inhibitor of FLT3 receptor tyrosine kinase (IC50 = 42 nM) that displays selectivity over a range of other kinases.
| Trivial name | TCS 359 10mM * 1mL in DMSO |
| Catalog Number | A12427-10mM-D |
| Alternative Name(s) | 2-[(3,4-Dimethoxybenzoyl)amino]-4,5?,6,7-benzo[b]thiophene-3-carboxamide |
| Molecular Formula | C18H20N2O4S |
| CAS# | 301305-73-7 |
| SMILES | COC1=C(C=C(C=C1)C(=O)NC2=C(C3=C(S2)CCCC3)C(=O)N)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tcs-359.html |
