MKT 077 5mg
Occupies mortalin-2 (mot-2), a member of the Hsp70 family, at its p53 binding site and enables p53 translocation to the nucleus. Selectively cytotoxic; causes growth arrest of cancer cells in culture. Also inhibits telomerase activity and cross-links F-actin.
| Trivial name | MKT 077 5mg |
| Catalog Number | A12388-5 |
| Alternative Name(s) | 1-Ethyl-2-[[3-ethyl-5-(3-methyl-2(3?H)-benzothiazolylidene)-4-oxo-2-thiazolidinylidene?]methyl]-pyridinium chloride |
| Molecular Formula | C21H22ClN3OS2 |
| CAS# | 147366-41-4 |
| SMILES | CCN1/C(=C/C2=CC=CC=[N+]2CC)/S/C(=C/3N(C4=CC=CC=C4S3)C)/C1=O.[Cl-] |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/mkt-077.html |
