SR 144528 10mg
SR 144528 is a selective peripheral cannabinoid receptor inverse agonist that displays a Ki value of 0.6 nM for rat spleen and human recombinant CB2 receptors and a Ki value of 400 nM for rat brain and human recombinant CB1 receptors.
| Trivial name | SR 144528 10mg |
| Catalog Number | A12376-10 |
| Alternative Name(s) | 5-(4-chloro-3-methylphenyl)-1-[(4-methylphenyl)methyl]-N-[(1S,2S,4R)-1,3,3-trimethylbicyclo[2.2.1]hept-2-yl]-1H-pyrazole-3-carboxamide |
| Molecular Formula | C29H34ClN3O |
| CAS# | 192703-06-3 |
| SMILES | CC1=CC=C(C=C1)CN2C(=CC(=N2)C(=O)N[C@H]3[C@]4(CC[C@H](C4)C3(C)C)C)C5=CC(=C(C=C5)Cl)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/sr-144528.html |
