KY02111 10mM * 1mL in DMSO
KY02111 is a potent and selective Wnt signaling pathway inhibitor discovered by a cell-based screening, which promotes differentiation of hESCs/iPSCs to cardiomyocytes when used at the second stage of differenitation.
| Trivial name | KY02111 10mM * 1mL in DMSO |
| Catalog Number | A12362-10mM-D |
| Alternative Name(s) | N-(6-chlorobenzo[d]thiazol-2-yl)-3-(3,4-dimethoxyphenyl)propanamide |
| Molecular Formula | C18H17ClN2O3S |
| CAS# | 1118807-13-8 |
| SMILES | COC1=C(C=C(C=C1)CCC(=O)NC2=NC3=C(S2)C=C(C=C3)Cl)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ky02111.html |