Lonafarnib (SCH66336) 10mM * 1mL in DMSO
Lonafarnib (SCH 66336) is a selectively FPTase inhibitor for H-ras, K-ras-4B and N-ras with IC50 of 1.9 nM, 5.2 nM and 2.8 nM, respectively.
| Trivial name | Lonafarnib (SCH66336) 10mM * 1mL in DMSO |
| Catalog Number | A12328-10mM-D |
| Alternative Name(s) | 4-(2-(4-(8-Chloro-3,10-dibromo-6,11-dihydro-5H-benzo(5,6)cyclohepta(1,2-b)pyridin-11-yl)-1-piperidinyl)-2-oxoethyl)-1-piperidinecarboxamide |
| Molecular Formula | C27H31Br2ClN4O2 |
| CAS# | 193275-84-2 |
| SMILES | C1CN(CCC1CC(=O)N2CCC(CC2)[C@@H]3C4=C(C=C(C=C4CCC5=CC(=CN=C35)Br)Cl)Br)C(=O)N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/lonafarnib-sch66336.html |
