Betulin 2000mg
Betulin is a triterpene with a pentacyclic ring structure and hydroxyl groups in positions C3 and C28. Betulin has protective effects against cadmium induced apoptosis in human hepatoma cell lines.
| Trivial name | Betulin 2000mg |
| Catalog Number | A12210-2000 |
| Alternative Name(s) | N/A |
| Molecular Formula | C30H50O2 |
| CAS# | 473-98-3 |
| SMILES | CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)CO |
| Size | 2000mg |
| Supplier Page | http://www.adooq.com/betulin.html |
