Angelicin 10mg
Angelicin is a furanocoumarin typically isolated from the seeds of P. corylifolia. It has also been shown to prevent tacrine-induced cytotoxicity in human liver-derived HepG2 cells (EC50 = 47 ug/ml) and vascular relaxation in phenylephrine-precontracted rat aorta.
| Trivial name | Angelicin 10mg |
| Catalog Number | A12198-10 |
| Alternative Name(s) | 2H-?furo[2,?3-?h]-?1-?benzopyran-?2-?one |
| Molecular Formula | C11H6O3 |
| CAS# | 523-50-2 |
| SMILES | C1=CC2=C(C=CO2)C3=C1C=CC(=O)O3 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/angelicin.html |
