Piceatannol 10mM * 1mL in DMSO
Piceatannol is an anti-inflammatory, immunomodulatory and antiproliferative agent. Inhibits p56lck and syk protein tyrosine kinases and inhibits TNF-induced NF-??B activation and gene expression.
Trivial name | Piceatannol 10mM * 1mL in DMSO |
Catalog Number | A12162-10mM-D |
Alternative Name(s) | 4-[(1E)-2-(3,5-Dihydroxyphenyl)ethe?nyl]-1,2-benzenediol |
Molecular Formula | C14H12O4 |
CAS# | 10083-24-6 |
SMILES | C1=CC(=C(C=C1/C=C/C2=CC(=CC(=C2)O)O)O)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/piceatannol.html |