Oleuropein 50mg
Oleuropein is a phenylethanoid, a type of phenolic compound found in olive leaf from the olive tree together with other closely related compounds such as 10-hydroxyoleuropein, ligstroside, and 10-hydroxyligstroside.
| Trivial name | Oleuropein 50mg |
| Catalog Number | A12095-50 |
| Alternative Name(s) | Methyl (4S,5E,6S)-4-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-5-ethylidene-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-4H-pyran-3-carboxylate |
| Molecular Formula | C25H32O13 |
| CAS# | 32619-42-4 |
| SMILES | C/C=C/1[C@@H](C(=CO[C@H]1O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)OC)CC(=O)OCCC3=CC(=C(C=C3)O)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/oleuropein.html |
