Arctiin 5mg
Arctiin has shown to be a suppressor of cyclin D1 protein expression in multiple types of human tumor cells, such as osteosarcoma, lung, colorectal, cervical, breast, melanoma, and prostate cancer
| Trivial name | Arctiin 5mg |
| Catalog Number | A12019-5 |
| Alternative Name(s) | (3R,4R)-4-[(3,4-Dimethoxyphenyl)methyl]-3-[[4-(beta-D-glucopyranosyloxy)-3-methoxyphenyl]methyl]dihydro-2(3H)-furanone |
| Molecular Formula | C27H34O11 |
| CAS# | 20362-31-6 |
| SMILES | COC1=C(C=C(C=C1)C[C@H]2COC(=O)[C@@H]2CC3=CC(=C(C=C3)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)OC)OC |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/arctiin.html |