Schisandrin B 25mg
Schisandrin B is the most abundant dibenzocyclooctadiene isolated from the fruit of Schisandra chinensis (Turcz) Baillon or Wu-Wei-Zi (transliterally meaning “the fruit of five tastes” in Chinese), which is a commonly used tonic herb in Chinese medicine, particularly for the treatment of liver ailments.
| Trivial name | Schisandrin B 25mg |
| Catalog Number | A11991-25 |
| Alternative Name(s) | N/A |
| Molecular Formula | C23H28O6 |
| CAS# | 61281-37-6 |
| SMILES | CC1CC2=CC3=C(C(=C2C4=C(C(=C(C=C4CC1C)OC)OC)OC)OC)OCO3 |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/schisandrin-b.html |
