TMS 100mg
TMS is a potent, selective and competitive inhibitor of cytochrome P450 1B1, an enzyme overexpressed in certain tumors (IC50= 6 nM). 5N/A- and 520-fold selective over P450 1A1 and 1A2 respectively.
| Trivial name | TMS 100mg |
| Catalog Number | A11977-100 |
| Alternative Name(s) | 1-[2,(3,5-Dimethoxyphenyl)ethenyl]-?2,4-dimethoxybenzene |
| Molecular Formula | C18H20O4 |
| CAS# | 24144-92-1 |
| SMILES | COC1=CC(=C(C=C1)/C=C/C2=CC(=CC(=C2)OC)OC)OC |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/tms.html |
