TCS JNK 5a 10mM * 1mL in DMSO
TCS JNK 5a is a highly selective inhibitor of JNK2 and JNK3 (pIC50 values are 6.7, 6.5, <5.0 and <4.8 for JNK3, JNK2, JNK1 and p38?? respectively).
| Trivial name | TCS JNK 5a 10mM * 1mL in DMSO |
| Catalog Number | A11969-10mM-D |
| Alternative Name(s) | N-(3-Cyano-4,5,6,7-tetrahydrobenzo[?b]thienyl-2-yl)-1-naphthalenecarboxamide |
| Molecular Formula | C20H16N2OS |
| CAS# | 312917-14-9 |
| SMILES | C1CCC2=C(C1)C(=C(S2)NC(=O)C3=CC=CC4=CC=CC=C43)C#N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tcs-jnk-5a.html |