CTEP 10mM * 1mL in DMSO
CTEP is a highly potent, selective and orally bioavailable allosteric antagonist of mGlu5 receptor with an IC50 of 2.2 nM.
| Trivial name | CTEP 10mM * 1mL in DMSO |
| Catalog Number | A11968-10mM-D |
| Alternative Name(s) | 2-chloro-4-((2,5-dimethyl-1-(4-(trifluoromethoxy)phenyl)-1H-imidazol-4-yl)ethynyl)pyridine |
| Molecular Formula | C19H13ClF3N3O |
| CAS# | 871362-31-1 |
| SMILES | CC1=C(N=C(N1C2=CC=C(C=C2)OC(F)(F)F)C)C#CC3=CC(=NC=C3)Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ctep.html |