TCS PIM-1 4a 10mM * 1mL in DMSO
TCS PIM-1 4a is a selective and ATP-competitive Pim kinase inhibitor (IC50 values = 24 and 100 nM for Pim-1 and Pim-2, respectively).
| Trivial name | TCS PIM-1 4a 10mM * 1mL in DMSO |
| Catalog Number | A11967-10mM-D |
| Alternative Name(s) | (5Z)-5-[[3-(Trifluoromethyl)phenyl]methylene]-2,4-thiazolidinedione thiazolidine-2,4-dione, 4a |
| Molecular Formula | C11H6F3NO2S |
| CAS# | 438190-29-5 |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C=C2/C(=O)NC(=O)S2 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tcs-pim-1-4a.html |
