Y320 10mM * 1mL in DMSO
Y320 is an orally active immunomodulator, and inhibits IL-17 production by CD4 T cells stimulated with IL-15 with IC50 of 20 to 60 nM.
| Trivial name | Y320 10mM * 1mL in DMSO |
| Catalog Number | A11963-10mM-D |
| Alternative Name(s) | 1-(4-chlorophenyl)-N-(3-cyano-4-(4-morpholinopiperidin-1-yl)phenyl)-5-methyl-1H-pyrazole-4-carboxamide |
| Molecular Formula | C27H29ClN6O2 |
| CAS# | 288250-47-5 |
| SMILES | CC1=C(C=NN1C2=CC=C(C=C2)Cl)C(=O)NC3=CC(=C(C=C3)N4CCC(CC4)N5CCOCC5)C#N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/y320.html |
