AG-17 10mM * 1mL in DMSO
AG-17 is an inhibitor of EGF receptor kinase with an IC50 value of 460 ??M in the human epidermoid carcinoma cell line A431.
Trivial name | AG-17 10mM * 1mL in DMSO |
Catalog Number | A11949-10mM-D |
Alternative Name(s) | 2-?[[3,?5-?bis(1,?1-?dimethylethyl)-?4-?hydroxyphenyl]methylene]-?propanedinitrile |
Molecular Formula | C18H22N2O |
CAS# | 10537-47-0 |
SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C=C(C#N)C#N |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/ag-17.html |