AP26113 10mM * 1mL in DMSO
AP26113 has exhibited activity as a potent dual inhibitor of anaplastic lymphoma kinase (ALK) and epidermal growth factor receptor (EGFR).
| Trivial name | AP26113 10mM * 1mL in DMSO |
| Catalog Number | A11948-10mM-D |
| Alternative Name(s) | (2-((5-chloro-2-((4-(4-(dimethylamino)piperidin-1-yl)-2-methoxyphenyl)amino)pyrimidin-4-yl)amino)phenyl)dimethylphosphine oxide |
| Molecular Formula | C26H34ClN6O2P |
| CAS# | 1197958-12-5 |
| SMILES | CN(C)C1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC=CC=C4P(=O)(C)C)Cl)OC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ap26113.html |
