LCL-161 10mM * 1mL in DMSO
LCL161 is an orally bioavailable second mitochondrial-derived activator of caspases (SMAC) mimetic and inhibitor of IAP (Inhibitor of Apoptosis Protein) family of proteins, with potential antineoplastic activity.
| Trivial name | LCL-161 10mM * 1mL in DMSO |
| Catalog Number | A11928-10mM-D |
| Alternative Name(s) | (S)-N-((S)-1-cyclohexyl-2-((S)-2-(4-(4-fluorobenzoyl)thiazol-2-yl)pyrrolidin-1-yl)-2-oxoethyl)-2-(methylamino)propanamide |
| Molecular Formula | C26H33FN4O3S |
| CAS# | 1005342-46-0 |
| SMILES | C[C@@H](C(=O)N[C@@H](C1CCCCC1)C(=O)N2CCC[C@H]2C3=NC(=CS3)C(=O)C4=CC=C(C=C4)F)NC |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/lcl-161.html |
