ARN-509 10mg
ARN-509 is an androgen receptor antagonist with potential antineoplastic activity. ARN-509 binds to AR in target tissues thereby preventing androgen-induced receptor activation and facilitating the formation of inactive complexes that cannot be translocated to the nucleus. This prevents binding to and transcription of AR-responsive genes.
| Trivial name | ARN-509 10mg |
| Catalog Number | A11923-10 |
| Alternative Name(s) | 4-(7-(6-cyano-5-(trifluoromethyl)pyridin-3-yl)-8-oxo-6-thioxo-5,7-diazaspiro[3.4]octan-5-yl)-2-fluoro-N-methylbenzamide |
| Molecular Formula | C21H15F4N5O2S |
| CAS# | 956104-40-8 |
| SMILES | CNC(=O)C1=C(C=C(C=C1)N2C(=S)N(C(=O)C23CCC3)C4=CN=C(C(=C4)C(F)(F)F)C#N)F |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/arn-509.html |
