Pravastatin sodium 10mM * 1mL in DMSO
Pravastatin sodium is a water-soluble, competitive inhibitor of 3-hydroxy-3-methyl coenzyme A (HMG-CoA) reductase. Potently blocks cholesterol synthesis in vivo (Ki~ 1 nM) and displays cardioprotective properties.
Trivial name | Pravastatin sodium 10mM * 1mL in DMSO |
Catalog Number | A11912-10mM-D |
Alternative Name(s) | N/A |
Molecular Formula | C23H35NaO7 |
CAS# | 81131-70-6 |
SMILES | CC[C@H](C)C(=O)O[C@H]1C[C@@H](C=C2[C@H]1[C@H]([C@H](C=C2)C)CC[C@H](C[C@H](CC(=O)[O-])O)O)O.[Na+] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/pravastatin-sodium.html |