Pefloxacin mesylate 10mM * 1mL in DMSO
Pefloxacin mesylate is a synthetic chemotherapeutic agent and an antibacterial agent with IC5N/A of 6.7 nM.
| Trivial name | Pefloxacin mesylate 10mM * 1mL in DMSO |
| Catalog Number | A11902-10mM-D |
| Alternative Name(s) | 1-ethyl-6-fluoro-7-(4-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid mesylate |
| Molecular Formula | C17H20FN3O3.CH4O3S |
| CAS# | 70458-95-6 |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O.CS(=O)(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/pefloxacin-mesylate.html |
