Butenafine HCl 10mM * 1mL in DMSO
Butenafine Hydrochloride is an antifungal which is used to control dermal fungal infections such as athletes foot and ring worm.
| Trivial name | Butenafine HCl 10mM * 1mL in DMSO |
| Catalog Number | A11829-10mM-D |
| Alternative Name(s) | N-(4-tert-Butylbenzyl)-N-methyl-1-naphthalenemethylamine hydrochloride |
| Molecular Formula | C23H28ClN |
| CAS# | 101827-46-7 |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CN(C)CC2=CC=CC3=CC=CC=C32.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/butenafine-hcl.html |