Prostaglandin E1 (PGE1) 25mg
Prostaglandin E1 (PGE1) is the theoretical cyclooxygenase metabolite of dihomo-??-linolenic acid (DGLA), but it is virtually undetectable in the plasma of normal humans or other animals. The IC50 of PGE1 for the inhibition of ADP-induced human platelet aggregation is 40 nM.
Trivial name | Prostaglandin E1 (PGE1) 25mg |
Catalog Number | A11820-25 |
Alternative Name(s) | N/A |
Molecular Formula | C20H34O5 |
CAS# | 745-65-3 |
SMILES | CCCCC[C@@H](/C=C/[C@H]1[C@@H](CC(=O)[C@@H]1CCCCCCC(=O)O)O)O |
Size | 25mg |
Supplier Page | http://www.adooq.com/prostaglandin-e1-pge1.html |