Azithromycin (Zithromax) 10mM * 1mL in DMSO
Azithromycin is an azalide antibiotic, which inhibits the growth of gram negative bacteria, such as Haemophilus influenza.
| Trivial name | Azithromycin (Zithromax) 10mM * 1mL in DMSO |
| Catalog Number | A11803-10mM-D |
| Alternative Name(s) | 9-Deoxo-9a-methyl-9a-aza-homoerythromycin A |
| Molecular Formula | C38H72N2O12 |
| CAS# | 83905-01-5 |
| SMILES | CC[C@@H]1[C@@]([C@@H]([C@H](N(C[C@@H](C[C@@]([C@@H]([C@H]([C@@H]([C@H](C(=O)O1)C)O[C@H]2C[C@@]([C@H]([C@@H](O2)C)O)(C)OC)C)O[C@H]3[C@@H]([C@H](C[C@H](O3)C)N(C)C)O)(C)O)C)C)C)O)(C)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/azithromycin-zithromax.html |
