Atorvastatin calcium 10mM * 1mL in DMSO
Atorvastatin (Lipitor) is an inhibitor of HMG-CoA reductase used as a cholesterol-lowering medication that blocks the production of cholesterol.
| Trivial name | Atorvastatin calcium 10mM * 1mL in DMSO |
| Catalog Number | A11800-10mM-D |
| Alternative Name(s) | [R-(R*, R*)]-7-[2-(4-Fluorophenyl)-5-(1-methylethyl)-3-phenyl-4-(phenylaminocarbonyl)-1H-pyrrol-1-yl]-3,5-dihydroxy-heptanoic acid calcium salt |
| Molecular Formula | 2(C33H34FN2O5).Ca |
| CAS# | 134523-03-8 |
| SMILES | CC(C)C1=C(C(=C(N1CC[C@H](C[C@H](CC(=O)[O-])O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4.CC(C)C1=C(C(=C(N1CC[C@H](C[C@H](CC(=O)[O-])O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4.[Ca+2] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/atorvastatin-calcium.html |