WP1066 10mM * 1mL in DMSO
WP1066 is a novel JAK2 inhibitor and it suppresses proliferation and induces apoptosis in eythroid human cells carrying the JAK2 V617F mutation.
| Trivial name | WP1066 10mM * 1mL in DMSO |
| Catalog Number | A11795-10mM-D |
| Alternative Name(s) | (E)-3(6-bromopyridin-2-yl)-2-cyano-N-(S0-1phenylethyl)acrylamide |
| Molecular Formula | C17H14BrN3O |
| CAS# | 857064-38-1 |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)/C(=C/C2=NC(=CC=C2)Br)/C#N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/wp1066.html |
