CPI-613 10mM * 1mL in DMSO
CPI-613 is a racemic mixture of the enantiomers of a synthetic alpha-lipoic lipoic acid analogue with potential chemopreventive and antineoplastic activities.
| Trivial name | CPI-613 10mM * 1mL in DMSO |
| Catalog Number | A11786-10mM-D |
| Alternative Name(s) | 6,8-bis(benzylthio)octanoic acid |
| Molecular Formula | C22H28O2S2 |
| CAS# | 95809-78-2 |
| SMILES | C1=CC=C(C=C1)CSCCC(CCCCC(=O)O)SCC2=CC=CC=C2 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cpi-613.html |