PF 4708671 25mg
PF 4708671 is a highly specific inhibitor of p70 ribosomal S6 kinase (S6K1) that inhibits S6K1-mediated phosphorylation of S6 protein in response to IGF-1 , while having no effect on highly related RSK and MSK kinases.
| Trivial name | PF 4708671 25mg |
| Catalog Number | A11755-25 |
| Alternative Name(s) | 2-[[4-(5-Ethylpyrimidin-4-yl)piperazin-1-yl]methyl]-5-(trifluoromethyl)-1H-benzo[d]imidazole |
| Molecular Formula | C19H21F3N6 |
| CAS# | 1255517-76-0 |
| SMILES | CCC1=CN=CN=C1N2CCN(CC2)CC3=NC4=C(N3)C=C(C=C4)C(F)(F)F |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/pf-4708671.html |
