Ibutilide fumarate 10mM * 1mL in DMSO
Ibutilide is a Class III antiarrhythmic agent that is indicated for acute cardioconversion of atrial fibrillation and atrial flutter of a recent onset to sinus rhythm. It exerts its antiarrhythmic effect by induction of slow inward sodium current, which prolongs action potential and refractory period (physiology) of myocardial cells.
| Trivial name | Ibutilide fumarate 10mM * 1mL in DMSO |
| Catalog Number | A11750-10mM-D |
| Alternative Name(s) | N-[4-[4-(ethyl-heptyl-amino)-1-hydroxy-butyl]phenyl]methanesulfonamide fumarate |
| Molecular Formula | (C20H36N2O3S)2.C4H4O |
| CAS# | 122647-32-9 |
| SMILES | CCCCCCCN(CC)CCCC(C1=CC=C(C=C1)NS(=O)(=O)C)O.CCCCCCCN(CC)CCCC(C1=CC=C(C=C1)NS(=O)(=O)C)O.C(=C/C(=O)O)C(=O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ibutilide-fumarate.html |