Moexipril hydrochloride 10mM * 1mL in DMSO
Moexipril hydrochloride is a potent orally active non-sulfhydryl angiotensin converting enzyme inhibitor (ACE) which is used for the treatment of hypertension and congestive heart failure.
| Trivial name | Moexipril hydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A11745-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C27H34N2O7.HCl |
| CAS# | 82586-52-5 |
| SMILES | CCOC(=O)[C@H](CCC1=CC=CC=C1)N[C@@H](C)C(=O)N2CC3=CC(=C(C=C3C[C@H]2C(=O)O)OC)OC.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/moexipril-hydrochloride.html |
